CAS 1374509-61-1

Ethyl 2-(2-methoxyacetyl)-5-methylhexanoate

Description:

Ethyl 2-(2-methoxyacetyl)-5-methylhexanoate, identified by its CAS number 1374509-61-1, is an organic compound characterized by its ester functional group, which is typical of many flavor and fragrance compounds. This substance features a hexanoate backbone, indicating a six-carbon chain, with additional substituents that include a methoxyacetyl group and a methyl group. The presence of the methoxy group suggests potential solubility in organic solvents and may impart specific aromatic properties. Ethyl esters generally exhibit pleasant, fruity odors, making them valuable in the food and cosmetic industries. The compound's molecular structure contributes to its reactivity and potential applications in synthesis or as an intermediate in organic chemistry. Additionally, its physical properties, such as boiling point and solubility, would be influenced by the ester and alkyl groups present. Safety and handling considerations are essential, as with all chemical substances, to ensure proper usage and minimize risks associated with exposure.

Formula: C₁₂H₂₂O₄

InChI: InChI=1S/C12H22O4/c1-5-16-12(14)10(7-6-9(2)3)11(13)8-15-4/h9-10H,5-8H2,1-4H3

InChI key: InChIKey=XAHPVEPDQMEUEY-UHFFFAOYSA-N

SMILES: C(C(COC)=O)(C(OCC)=O)CCC(C)C

Synonyms:

• Ethyl 2-(2-methoxyacetyl)-5-methylhexanoate
• Hexanoic acid, 2-(2-methoxyacetyl)-5-methyl-, ethyl ester