CAS 1374510-75-4
:1-[7-[2-(Dimethylamino)ethenyl]-2-(2-furanyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-(2-furanyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1374510-75-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazolo-pyrimidine core and a dimethylamino group. This compound features a furan ring, contributing to its aromatic properties, and an ethanone moiety, which may influence its reactivity and potential biological activity. The presence of the dimethylamino group suggests that it may exhibit basic properties, potentially allowing for interactions with various biological targets. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. As with many synthetic compounds, understanding its characteristics requires further investigation through experimental studies, including spectroscopic analysis and biological assays, to elucidate its potential applications and mechanisms of action.
Formula:C15H15N5O2
InChI:InChI=1S/C15H15N5O2/c1-10(21)11-9-16-15-17-14(13-5-4-8-22-13)18-20(15)12(11)6-7-19(2)3/h4-9H,1-3H3
InChI key:InChIKey=KYCOFCGXGHPLEB-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(=N2)C3=CC=CO3)N=CC1C(C)=O
Synonyms:- 1-[7-[2-(Dimethylamino)ethenyl]-2-(2-furanyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
- Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-(2-furanyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
- (E)-1-(7-(2-(dimethylamino)vinyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethan-1-one
- 1-[7-[(E)-2-(Dimethylamino)vinyl]-2-(2-furyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.