CAS 1374510-86-7
:Methyl 2-[2-(dimethylamino)ethenyl]-6-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate
Description:
Methyl 2-[2-(dimethylamino)ethenyl]-6-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate, with CAS number 1374510-86-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a naphthyridine core, a triazole moiety, and a carboxylate functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the dimethylamino group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the compound's structural features may confer specific reactivity patterns, making it suitable for various chemical transformations. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its efficacy in biological assays, particularly in the context of drug development. Overall, this compound represents a class of molecules that could have applications in medicinal chemistry and related fields.
Formula:C18H20N6O3
InChI:InChI=1S/C18H20N6O3/c1-11-20-21-12(2)24(11)23-9-7-15-13(17(23)25)10-14(18(26)27-5)16(19-15)6-8-22(3)4/h6-10H,1-5H3
InChI key:InChIKey=VDDICPDRSMKGIT-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC(C=CN(C)C)=C(C(OC)=O)C2)C=CN1N3C(C)=NN=C3C
Synonyms:- Methyl 2-[2-(dimethylamino)ethenyl]-6-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate
- 1,6-Naphthyridine-3-carboxylic acid, 2-[2-(dimethylamino)ethenyl]-6-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-5,6-dihydro-5-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.