CAS 1374510-90-3: Methyl 2-[2-(dimethylamino)ethenyl]-6-(2-furanylmethyl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate
Description:Methyl 2-[2-(dimethylamino)ethenyl]-6-(2-furanylmethyl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate is a complex organic compound characterized by its unique structural features, which include a naphthyridine core, a furan moiety, and a dimethylamino group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its intricate molecular architecture. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the dimethylamino group can influence its basicity and reactivity, potentially enhancing its interaction with biological targets. The furan ring may contribute to its aromatic character and stability, while the overall structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature.
Formula:C19H19N3O4
InChI:InChI=1S/C19H19N3O4/c1-21(2)8-6-17-15(19(24)25-3)11-14-16(20-17)7-9-22(18(14)23)12-13-5-4-10-26-13/h4-11H,12H2,1-3H3
InChI key:InChIKey=NACZFMURHPCIGV-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC2=C(N=C1C=CN(C)C)C=CN(C2=O)CC=3OC=CC3
- Synonyms:
- Methyl 2-[2-(dimethylamino)ethenyl]-6-(2-furanylmethyl)-5,6-dihydro-5-oxo-1,6-naphthyridine-3-carboxylate
- 1,6-Naphthyridine-3-carboxylic acid, 2-[2-(dimethylamino)ethenyl]-6-(2-furanylmethyl)-5,6-dihydro-5-oxo-, methyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | methyl 2-[(E)-2-(dimethylamino)vinyl]-6-(2-furylmethyl)-5-oxo-5,6-dihydro-1,6-naphthyridine-3-carboxylate REF: 10-F372554CAS: 1374510-90-3 | - - - | - - - | Discontinued product |
![]() | Methyl 2-[(E)-2-(dimethylamino)vinyl]-6-(2-furylmethyl)-5-oxo-5,6-dihydro-1,6-naphthyridine-3-carboxylate REF: 3D-FM129866CAS: 1374510-90-3 | Min. 95% | - - - | Discontinued product |

methyl 2-[(E)-2-(dimethylamino)vinyl]-6-(2-furylmethyl)-5-oxo-5,6-dihydro-1,6-naphthyridine-3-carboxylate
Ref: 10-F372554
1g | Discontinued | Request information |

Methyl 2-[(E)-2-(dimethylamino)vinyl]-6-(2-furylmethyl)-5-oxo-5,6-dihydro-1,6-naphthyridine-3-carboxylate
Ref: 3D-FM129866
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |