CAS 13746-96-8
:Nitric acid, neodymium(3+) salt, hydrate
Description:
Nitric acid, neodymium(3+) salt, hydrate, with the CAS number 13746-96-8, is a coordination compound formed from neodymium ions and nitric acid. This substance typically appears as a crystalline solid, often exhibiting a characteristic color due to the presence of neodymium, which can range from green to violet depending on its oxidation state and coordination environment. As a hydrate, it contains water molecules integrated into its crystal structure, which can influence its stability and solubility. Neodymium(3+) ions are known for their strong magnetic properties and are often used in various applications, including lasers and magnets. The presence of nitric acid contributes to the compound's acidic nature, which can affect its reactivity and interactions with other substances. In terms of safety, like many neodymium salts, it should be handled with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during handling and storage.
Formula:H2O·xHNO3·xNd
InChI:InChI=1S/HNO3.Nd.H2O/c2-1(3)4;;/h(H,2,3,4);;1H2
InChI key:InChIKey=WOKQPWGHOKWVDT-UHFFFAOYSA-N
SMILES:N(=O)(=O)O.[Nd].O
Synonyms:- Neodymium - Nitric Acid (1:1) Hydrate
- Neodymium nitrate hydrate
- Neodymium trinitrate hydrate
- Neodymium(+3) Cation Nitrate Hydrate
- Nitric acid, neodymium(3+) salt, hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Neodymium(III) nitrate hydrate, REacton™, 99.99% (REO)
CAS:It is used as pharmaceutical intermediates. It is used in the selective PVC membrane sensors. The sensor with ionophore (L1) exhibits significantly enhanced selectivity towards neodymium (III). This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. So
Formula:N3NdO9Purity:99.99%Molecular weight:330.25Neodymium nitrate hydrate, 99.9%
CAS:Formula:Nd(NO3)3·xH2OPurity:≥ 99.9%Color and Shape:Lavender to purple powder or crystalsMolecular weight:330.26Neodymium(III) nitrate hydrate
CAS:Neodymium(III) nitrate hydratePurity:99.999%Molecular weight:348.27g/molNeodymium nitrate hydrate, 99.99%
CAS:Formula:Nd(NO3)3·xH2OPurity:≥ 99.99%Color and Shape:Pink to purple powder or crystalsMolecular weight:330.26Nitric acid, neodymium(3+) salt, hydrate (8CI,9CI)
CAS:Formula:H2N3NdO10Purity:99%Molecular weight:348.2700



