CAS 1374601-41-8

2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid

Description:

2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid is a complex organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a benzoylamino group, indicating the presence of a benzoyl group attached to an amino group, which contributes to its potential biological activity. The 3-phenylpropyl substituent adds a hydrophobic character, influencing its solubility and interaction with biological membranes. The carboxylic acid functional group at the 5-position of the benzimidazole ring provides acidic properties, allowing for potential ionization in physiological conditions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity suggests potential interactions with various biological targets, and its unique combination of functional groups may contribute to its reactivity and stability. As with many organic compounds, its characteristics, including solubility, melting point, and reactivity, would depend on the specific conditions under which it is studied.

Formula: C₂₄H₂₁N₃O₃

InChI: InChI=1S/C24H21N3O3/c28-22(18-11-5-2-6-12-18)26-24-25-20-16-19(23(29)30)13-14-21(20)27(24)15-7-10-17-8-3-1-4-9-17/h1-6,8-9,11-14,16H,7,10,15H2,(H,29,30)(H,25,26,28)

InChI key: InChIKey=WPXMEOBILYVKBC-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)N2C=3C(N=C2NC(=O)C4=CC=CC=C4)=CC(C(O)=O)=CC3

Synonyms:

• 2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid
• BRD9539
• 2-Benzamido-1-(3-phenylpropyl)-1H-benzo[d]imidazole-5-carboxylic acid
• BRD 9539
• 1H-Benzimidazole-5-carboxylic acid, 2-(benzoylamino)-1-(3-phenylpropyl)-

BRD9539

CAS: 1374601-41-8

BRD9539

Purity: ≥95%

Molecular weight: 399.44g/mol

Ref: 54-BUP05767

BRD9539

CAS: 1374601-41-8

BRD9539 is an inhibitor of euchromatin histone methyltransferase 2 (EHMT2), also known as G9a, with an IC50 value of 6.3 μM

Formula: C₂₄H₂₁N₃O₃

Purity: 98% - 99.57%

Color and Shape: Solid

Molecular weight: 399.44

Ref: TM-T7378

BRD9539

CAS: 1374601-41-8

BRD9539 is a small molecule modulator, which is a synthetic compound developed to interact with specific biological pathways. It is designed using advanced organic synthesis techniques and computational modeling, aimed at targeting specific molecular functions within cell signaling pathways. The mode of action of BRD9539 involves the inhibition of particular enzymes or protein interactions that are crucial in the regulation of cellular proliferation and survival.

Formula: C₂₄H₂₁N₃O₃

Purity: Min. 95%

Molecular weight: 399.44 g/mol

Ref: 3D-ZEC60141