CAS 1374601-41-8
:2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid
Description:
2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid is a complex organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a benzoylamino group, indicating the presence of a benzoyl group attached to an amino group, which contributes to its potential biological activity. The 3-phenylpropyl substituent adds a hydrophobic character, influencing its solubility and interaction with biological membranes. The carboxylic acid functional group at the 5-position of the benzimidazole ring provides acidic properties, allowing for potential ionization in physiological conditions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity suggests potential interactions with various biological targets, and its unique combination of functional groups may contribute to its reactivity and stability. As with many organic compounds, its characteristics, including solubility, melting point, and reactivity, would depend on the specific conditions under which it is studied.
Formula:C24H21N3O3
InChI:InChI=1S/C24H21N3O3/c28-22(18-11-5-2-6-12-18)26-24-25-20-16-19(23(29)30)13-14-21(20)27(24)15-7-10-17-8-3-1-4-9-17/h1-6,8-9,11-14,16H,7,10,15H2,(H,29,30)(H,25,26,28)
InChI key:InChIKey=WPXMEOBILYVKBC-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)N2C=3C(N=C2NC(=O)C4=CC=CC=C4)=CC(C(O)=O)=CC3
Synonyms:- 2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid
- BRD9539
- 2-Benzamido-1-(3-phenylpropyl)-1H-benzo[d]imidazole-5-carboxylic acid
- BRD 9539
- 1H-Benzimidazole-5-carboxylic acid, 2-(benzoylamino)-1-(3-phenylpropyl)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
BRD9539
CAS:BRD9539 is an inhibitor of euchromatin histone methyltransferase 2 (EHMT2), also known as G9a, with an IC50 value of 6.3 μMFormula:C24H21N3O3Purity:99.57% - 99.89%Color and Shape:SolidMolecular weight:399.4418BRD9539
CAS:BRD9539 is a small molecule modulator, which is a synthetic compound developed to interact with specific biological pathways. It is designed using advanced organic synthesis techniques and computational modeling, aimed at targeting specific molecular functions within cell signaling pathways. The mode of action of BRD9539 involves the inhibition of particular enzymes or protein interactions that are crucial in the regulation of cellular proliferation and survival.Formula:C24H21N3O3Purity:Min. 95%Molecular weight:399.44 g/mol




