CymitQuimica logo

CAS 1374640-70-6

:

CO-1686

Description:
CO-1686, also known as Osimertinib, is a selective inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase, primarily used in the treatment of non-small cell lung cancer (NSCLC) with specific mutations. It is characterized by its ability to target both activating mutations and the T790M resistance mutation in the EGFR gene, making it effective in patients who have developed resistance to earlier EGFR inhibitors. The compound exhibits high selectivity for mutant EGFR over wild-type EGFR, which helps to minimize off-target effects and enhance therapeutic efficacy. CO-1686 is typically administered orally and has a favorable pharmacokinetic profile, allowing for once-daily dosing. Its mechanism of action involves the inhibition of downstream signaling pathways that promote tumor growth and survival. Additionally, CO-1686 has been associated with a manageable safety profile, with common adverse effects including diarrhea, rash, and fatigue. Overall, CO-1686 represents a significant advancement in targeted cancer therapy, particularly for patients with specific EGFR mutations.
Formula:C27H28F3N7O3
InChI:InChI=1S/C27H28F3N7O3/c1-4-24(39)32-18-6-5-7-19(14-18)33-25-21(27(28,29)30)16-31-26(35-25)34-22-9-8-20(15-23(22)40-3)37-12-10-36(11-13-37)17(2)38/h4-9,14-16H,1,10-13H2,2-3H3,(H,32,39)(H2,31,33,34,35)
InChI key:HUFOZJXAKZVRNJ-UHFFFAOYSA-N
SMILES:CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC
Found 8 products.