CAS 1374651-38-3

Phenylmethyl octahydro-6,9-dioxo-2H-pyrazino[1,2-a]pyrazine-2-carboxylate

Description:

Phenylmethyl octahydro-6,9-dioxo-2H-pyrazino[1,2-a]pyrazine-2-carboxylate, identified by its CAS number 1374651-38-3, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a pyrazine core. This compound features multiple functional groups, including carboxylate and carbonyl moieties, contributing to its potential reactivity and biological activity. The presence of the phenylmethyl group suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The octahydro configuration indicates a saturated ring system, which may enhance stability and reduce reactivity compared to unsaturated analogs. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. However, specific biological activities and applications would require further investigation through empirical studies. Overall, the unique structural features of this compound position it as a candidate for research in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₇N₃O₄

InChI: InChI=1S/C15H17N3O4/c19-13-8-16-14(20)12-9-17(6-7-18(12)13)15(21)22-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,20)

InChI key: InChIKey=KTDXAWNNDPGABG-UHFFFAOYSA-N

SMILES: O=C1C2N(CCN(C(OCC3=CC=CC=C3)=O)C2)C(=O)CN1

Synonyms:

• 2H-Pyrazino[1,2-a]pyrazine-2-carboxylic acid, octahydro-6,9-dioxo-, phenylmethyl ester
• Phenylmethyl octahydro-6,9-dioxo-2H-pyrazino[1,2-a]pyrazine-2-carboxylate

2-CBZ-6,9-DIOXOOCTAHYDROPYRAZINO[1,2-A]PYRAZINE

CAS: 1374651-38-3

Formula: C₁₅H₁₇N₃O₄

Purity: 97.0%

Molecular weight: 303.318

Ref: 10-F300678