CymitQuimica logo

CAS 1374652-64-8

:

3-Chloro-N-methyl-6-isoquinolinamine

Description:
3-Chloro-N-methyl-6-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. The presence of a chlorine atom at the 3-position and a methylamino group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's electronic properties and steric effects, which may affect its pharmacological profile. Additionally, the presence of the isoquinoline moiety is often associated with various biological activities, including antimicrobial and anticancer properties. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c1-12-9-3-2-7-6-13-10(11)5-8(7)4-9/h2-6,12H,1H3
InChI key:InChIKey=FLDCMVPRHDLNFJ-UHFFFAOYSA-N
SMILES:N(C)C1=CC2=C(C=C1)C=NC(Cl)=C2
Synonyms:
  • 6-Isoquinolinamine, 3-chloro-N-methyl-
  • 3-Chloro-N-methyl-6-isoquinolinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.