CAS 1374986-05-6

Methyl 5-chloroisoxazolo[4,5-b]pyrazine-3-carboxylate

Description:

Methyl 5-chloroisoxazolo[4,5-b]pyrazine-3-carboxylate is a heterocyclic compound characterized by its unique isoxazole and pyrazine ring structures. This compound features a chlorine substituent at the 5-position of the isoxazole ring and a carboxylate group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic applications. Its molecular structure suggests potential biological activity, which may be explored in drug development, particularly in the context of targeting specific biological pathways. The compound's properties, such as melting point, boiling point, and solubility, are influenced by its functional groups and ring systems. As a relatively specialized compound, it may not be widely encountered outside of specific research contexts, but it holds promise for further investigation in the fields of organic synthesis and pharmacology. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₇H₄ClN₃O₃

InChI: InChI=1S/C7H4ClN3O3/c1-13-7(12)5-4-6(14-11-5)9-2-3(8)10-4/h2H,1H3

InChI key: InChIKey=WCIHVCUELIPOED-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(ON1)=NC=C(Cl)N2

Synonyms:

• Isoxazolo[4,5-b]pyrazine-3-carboxylic acid, 5-chloro-, methyl ester
• Methyl 5-chloroisoxazolo[4,5-b]pyrazine-3-carboxylate
• 5-Chloropyrazino[2,3-d]isoxazole-3-carboxylic acid methyl ester

methyl 5-chloroisoxazolo[4,5-b]pyrazine-3-carboxylate

CAS: 1374986-05-6

Formula: C₇H₄ClN₃O₃

Molecular weight: 213.5780

Ref: IN-DA00HV1E