CAS 137504-86-0
:4-Chloro-3-fluorobenzeneboronic acid
Description:
4-Chloro-3-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and halogen substituents on a benzene ring. Its molecular structure features a benzene ring with a chlorine atom at the para position and a fluorine atom at the meta position relative to the boronic acid group. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds. The presence of both chlorine and fluorine atoms can influence its reactivity and selectivity in various chemical reactions. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them valuable in the development of sensors and in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential toxicity and environmental concerns.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H
SMILES:c1cc(c(cc1B(O)O)F)Cl
Synonyms:- 4-Chloro-3-Fluorophenylboronic Acid
- Akos Brn-0033
- Bio-Farma Bf000449
- 4-Chloro-3-fluorobenzeneboronicacid
- (4-Chloro-3-Fluorophenyl)-Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloro-3-fluorobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5BClFO2Purity:97%Molecular weight:174.36Boronic acid, B-(4-chloro-3-fluorophenyl)-
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:SolidMolecular weight:174.36514-Chloro-3-fluorobenzeneboronic acid
CAS:4-Chloro-3-fluorobenzeneboronic acidFormula:C6H5BClFO2Purity:98%Color and Shape: white powderMolecular weight:174.37g/mol4-Chloro-3-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BClFO2Purity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:174.364-Chloro-3-fluorobenzeneboronic acid
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:SolidMolecular weight:174.36





