CAS 1375064-60-0
:1-(3-Bromo-7-methyl-1H-indol-1-yl)ethanone
Description:
1-(3-Bromo-7-methyl-1H-indol-1-yl)ethanone is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 3-position and a methyl group at the 7-position of the indole ring contributes to its unique chemical properties and reactivity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its reactivity in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important considerations in both laboratory and industrial applications.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c1-7-4-3-5-9-10(12)6-13(8(2)14)11(7)9/h3-6H,1-2H3
InChI key:InChIKey=UVUMFIYMNNFHAV-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(C(Br)=C1)=CC=CC2C
Synonyms:- 1-(3-Bromo-7-methyl-1H-indol-1-yl)ethanone
- Ethanone, 1-(3-bromo-7-methyl-1H-indol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
