CAS 1375069-07-0

Azetidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1)

Description:

Azetidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the cyclopropylmethoxy group introduces unique steric and electronic properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular interactions, stability, and potential applications would depend on the functional groups present and their spatial arrangement. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including its mechanism of action, toxicity, and potential therapeutic uses.

Formula: C₇H₁₃NO·ClH

InChI: InChI=1S/C7H13NO.ClH/c1-2-6(1)5-9-7-3-8-4-7;/h6-8H,1-5H2;1H

InChI key: InChIKey=QDJDUWJILFZNIP-UHFFFAOYSA-N

SMILES: O(CC1CC1)C2CNC2.Cl

Synonyms:

• Azetidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1)

3-(Cyclopropylmethoxy)azetidine hydrochloride

CAS: 1375069-07-0

3-(Cyclopropylmethoxy)azetidine hydrochloride

Purity: 95%

Molecular weight: 163.65g/mol

Ref: 54-OR960080