CAS 1375069-14-9

3-Amino-5-bromo-N-methylbenzamide

Description:

3-Amino-5-bromo-N-methylbenzamide is an organic compound characterized by the presence of an amino group, a bromo substituent, and a methyl group attached to a benzamide structure. The amino group (-NH2) contributes to its basicity and potential reactivity, while the bromo substituent (-Br) can influence its electrophilic properties and reactivity in substitution reactions. The N-methyl group indicates that a methyl group is attached to the nitrogen atom of the amide, which can affect the compound's solubility and steric hindrance. This compound may exhibit polar characteristics due to the presence of the amide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of bromine may impart unique properties, such as increased lipophilicity or specific reactivity patterns in chemical reactions. Overall, 3-Amino-5-bromo-N-methylbenzamide is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₈H₉BrN₂O

InChI: InChI=1S/C8H9BrN2O/c1-11-8(12)5-2-6(9)4-7(10)3-5/h2-4H,10H2,1H3,(H,11,12)

InChI key: InChIKey=UTWLHIBXQJXIMG-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=CC(Br)=CC(N)=C1

Synonyms:

• Benzamide, 3-amino-5-bromo-N-methyl-
• 3-Amino-5-bromo-N-methylbenzamide

3-Amino-5-bromo-N-methylbenzamide

CAS: 1375069-14-9

Versatile small molecule scaffold

Formula: C₈H₉BrN₂O

Purity: Min. 95%

Molecular weight: 229.07 g/mol

Ref: 3D-AFC06914