CAS 13754-21-7
:6-amino-5-nitropyrimidine-4(1H)-thione
Description:
6-Amino-5-nitropyrimidine-4(1H)-thione is a heterocyclic compound characterized by its pyrimidine ring structure, which includes an amino group and a nitro group at specific positions. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a yellow to orange solid, exhibiting moderate solubility in polar solvents. Its molecular structure allows for potential interactions in biological systems, making it of interest in pharmaceutical research. The nitro group can participate in electrophilic substitution reactions, while the amino group can act as a nucleophile. Additionally, the thione functionality may influence the compound's acidity and basicity, affecting its behavior in different chemical environments. Overall, 6-amino-5-nitropyrimidine-4(1H)-thione is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C4H4N4O2S
InChI:InChI=1/C4H4N4O2S/c5-3-2(8(9)10)4(11)7-1-6-3/h1H,(H3,5,6,7,11)
InChI key:InChIKey=GBZNXKPARWLUIS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)NC=NC1=S
Synonyms:- 4(3H)-Pyrimidinethione, 6-amino-5-nitro-
- 4-Pyrimidinethiol, 6-Amino-5-Nitro-
- 6-Amino-5-nitro-4(3H)-pyrimidinethione
- 6-Amino-5-nitropyrimidine-4-thiol
- NSC 409301
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
