CAS 1375471-46-7

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,2,3-trimethylbutanoic acid

Description:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,2,3-trimethylbutanoic acid, with the CAS number 1375471-46-7, is a chemical compound characterized by its complex structure, which includes an amino acid moiety and a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with amino acids, such as the ability to form hydrogen bonds due to the presence of both carboxylic acid and amine functional groups. The dimethylethoxycarbonyl group serves as a protective group, enhancing the compound's stability and solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of peptide-based drugs. The presence of multiple methyl groups contributes to its steric hindrance, which may influence its reactivity and interactions with biological systems. Overall, this compound exemplifies the intricate balance of functional groups that can dictate the chemical behavior and potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₂H₂₃NO₄

InChI: InChI=1S/C12H23NO4/c1-10(2,3)17-9(16)13-12(6,7)11(4,5)8(14)15/h1-7H3,(H,13,16)(H,14,15)

InChI key: InChIKey=HKDLSKFRNMSGJO-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)(C)C)(NC(OC(C)(C)C)=O)(C)C

Synonyms:

• 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,2,3-trimethylbutanoic acid
• Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-2,2,3-trimethyl-
• 3-{[(tert-butoxy)carbonyl]amino}-2,2,3-trimethylbutanoic acid

3-{[(tert-Butoxy)carbonyl]amino}-2,2,3-trimethylbutanoic acid

CAS: 1375471-46-7

Versatile small molecule scaffold

Formula: C₁₂H₂₃NO₄

Purity: Min. 95%

Molecular weight: 245.32 g/mol

Ref: 3D-AFC47146