CAS 1375471-75-2

Benzenepropanoic acid, β-amino-α-methyl-, methyl ester, hydrochloride (1:1)

Description:

Benzenepropanoic acid, β-amino-α-methyl-, methyl ester, hydrochloride (1:1), with CAS number 1375471-75-2, is a chemical compound characterized by its structural features that include a benzene ring, a propanoic acid moiety, and an amino group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the methyl ester group indicates that it can undergo hydrolysis to release the corresponding acid, which may have implications for its reactivity and biological activity. As a hydrochloride salt, it is likely to exhibit stability under standard storage conditions, making it suitable for various applications in pharmaceuticals and research. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.

Formula: C₁₁H₁₅NO₂·ClH

InChI: InChI=1S/C11H15NO2.ClH/c1-8(11(13)14-2)10(12)9-6-4-3-5-7-9;/h3-8,10H,12H2,1-2H3;1H

InChI key: InChIKey=NDNSCCABAQFBQE-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)C)(N)C1=CC=CC=C1.Cl

Synonyms:

• Benzenepropanoic acid, β-amino-α-methyl-, methyl ester, hydrochloride (1:1)

Methyl 3-amino-2-methyl-3-phenylpropanoate hydrochloride

CAS: 1375471-75-2

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 229.7 g/mol

Ref: 3D-AFC47175