CAS 1375472-31-3

3-(Aminosulfonyl)-5-bromo-2-methylbenzoic acid

Description:

3-(Aminosulfonyl)-5-bromo-2-methylbenzoic acid, identified by its CAS number 1375472-31-3, is a chemical compound that features a benzoic acid structure with specific functional groups that impart unique characteristics. This compound contains a bromine atom, which contributes to its reactivity and potential applications in various chemical reactions. The presence of an aminosulfonyl group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical research. The methyl group on the benzene ring can affect the compound's steric properties and overall stability. As a benzoic acid derivative, it exhibits acidic properties, which can be relevant in various chemical contexts, including synthesis and formulation. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 3-(Aminosulfonyl)-5-bromo-2-methylbenzoic acid is characterized by its unique functional groups, reactivity, and potential utility in scientific research.

Formula: C₈H₈BrNO₄S

InChI: InChI=1S/C8H8BrNO4S/c1-4-6(8(11)12)2-5(9)3-7(4)15(10,13)14/h2-3H,1H3,(H,11,12)(H2,10,13,14)

InChI key: InChIKey=RVOLFSDFYXOZOL-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C)C(C(O)=O)=CC(Br)=C1

Synonyms:

• 3-(Aminosulfonyl)-5-bromo-2-methylbenzoic acid
• Benzoic acid, 3-(aminosulfonyl)-5-bromo-2-methyl-

5-Bromo-2-methyl-3-sulfamoylbenzoic acid

CAS: 1375472-31-3

Versatile small molecule scaffold

Formula: C₈H₈BrNO₄S

Purity: Min. 95%

Molecular weight: 294.12 g/mol

Ref: 3D-AFC47231