CAS 1375472-47-1

N,α-Dimethyl-4-(methylsulfinyl)benzenemethanamine

Description:

N,α-Dimethyl-4-(methylsulfinyl)benzenemethanamine, identified by its CAS number 1375472-47-1, is a chemical compound that features a benzene ring substituted with both a methylsulfinyl group and a dimethylamino group. This compound is characterized by its potential biological activity, which may include interactions with neurotransmitter systems, given the presence of the amine functional group. The methylsulfinyl moiety suggests possible involvement in redox reactions or metabolic pathways, as sulfoxides can act as oxidizing agents. The presence of multiple methyl groups contributes to its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the structural configuration may affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, N,α-Dimethyl-4-(methylsulfinyl)benzenemethanamine represents a compound of interest in medicinal chemistry, particularly in the context of drug design and development. Further studies would be necessary to elucidate its specific biological effects and potential applications.

Formula: C₁₀H₁₅NOS

InChI: InChI=1S/C10H15NOS/c1-8(11-2)9-4-6-10(7-5-9)13(3)12/h4-8,11H,1-3H3

InChI key: InChIKey=SCSJPBNMIUJMPJ-UHFFFAOYSA-N

SMILES: C(NC)(C)C1=CC=C(S(C)=O)C=C1

Synonyms:

• Benzenemethanamine, N,α-dimethyl-4-(methylsulfinyl)-
• N,α-Dimethyl-4-(methylsulfinyl)benzenemethanamine

[1-(4-Methanesulfinylphenyl)ethyl](methyl)amine

CAS: 1375472-47-1

Versatile small molecule scaffold

Formula: C₁₀H₁₅NOS

Purity: Min. 95%

Molecular weight: 197.3 g/mol

Ref: 3D-AFC47247