CAS 1375472-91-5

Azetidine, 3-(3-phenylpropoxy)-, hydrochloride (1:1)

Description:

Azetidine, 3-(3-phenylpropoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The compound features a phenylpropoxy group, indicating the presence of a phenyl group attached to a propoxy chain, which contributes to its overall hydrophobic character. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the hydrochloride moiety also suggests that it may exhibit improved stability and bioavailability. This compound may be of interest in medicinal chemistry, particularly for its potential biological activities, although specific pharmacological data would require further investigation. Its molecular interactions, solubility, and stability under various conditions are essential characteristics that would influence its practical applications in research and industry.

Formula: C₁₂H₁₇NO·ClH

InChI: InChI=1S/C12H17NO.ClH/c1-2-5-11(6-3-1)7-4-8-14-12-9-13-10-12;/h1-3,5-6,12-13H,4,7-10H2;1H

InChI key: InChIKey=VLOLIGIMMLNLOB-UHFFFAOYSA-N

SMILES: O(CCCC1=CC=CC=C1)C2CNC2.Cl

Synonyms:

• Azetidine, 3-(3-phenylpropoxy)-, hydrochloride (1:1)

3-(3-Phenylpropoxy)azetidine hydrochloride

CAS: 1375472-91-5

Versatile small molecule scaffold

Formula: C₁₂H₁₈ClNO

Purity: Min. 95%

Molecular weight: 227.73 g/mol

Ref: 3D-AFC47291