CAS 1375473-06-5

Glycine, N-[(5-chloro-2-thienyl)methyl]-, hydrochloride (1:1)

Description:

Glycine, N-[(5-chloro-2-thienyl)methyl]-, hydrochloride (1:1) is a synthetic compound characterized by its structural features, which include a glycine backbone modified with a 5-chloro-2-thienyl group. This modification imparts unique properties to the molecule, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the thienyl group suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. The compound's molecular interactions, such as hydrogen bonding and hydrophobic effects, can play a significant role in its pharmacokinetics and pharmacodynamics. Additionally, the chlorine substituent may enhance the compound's reactivity and selectivity in biological systems. Overall, this compound exemplifies the importance of structural modifications in developing new therapeutic agents.

Formula: C₇H₈ClNO₂S·ClH

InChI: InChI=1S/C7H8ClNO2S.ClH/c8-6-2-1-5(12-6)3-9-4-7(10)11;/h1-2,9H,3-4H2,(H,10,11);1H

InChI key: InChIKey=BOBIUMGUDDKVKV-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)C1=CC=C(Cl)S1.Cl

Synonyms:

• Glycine, N-[(5-chloro-2-thienyl)methyl]-, hydrochloride (1:1)

2-{[(5-Chlorothiophen-2-yl)methyl]amino}acetic acid hydrochloride

CAS: 1375473-06-5

Versatile small molecule scaffold

Formula: C₇H₉Cl₂NO₂S

Purity: Min. 95%

Molecular weight: 242.12 g/mol

Ref: 3D-AFC47306