CAS 1375473-10-1

Benzenesulfonamide, 4-hydrazinyl-N-2-thiazolyl-, hydrochloride (1:2)

Description:

Benzenesulfonamide, 4-hydrazinyl-N-2-thiazolyl-, hydrochloride (1:2) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a hydrazine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The thiazole ring contributes to the compound's biological activity, often enhancing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various formulations. The compound may exhibit properties such as antimicrobial activity, and its structure suggests potential for further modification to enhance efficacy or reduce toxicity. Safety and handling precautions should be observed, as with many sulfonamides and hydrazines, due to potential toxicity and reactivity. Overall, this compound represents a class of substances that are of interest in drug discovery and development, particularly in the context of infectious diseases and other therapeutic areas.

Formula: C₉H₁₀N₄O₂S₂·2ClH

InChI: InChI=1S/C9H10N4O2S2.2ClH/c10-12-7-1-3-8(4-2-7)17(14,15)13-9-11-5-6-16-9;;/h1-6,12H,10H2,(H,11,13);2*1H

InChI key: InChIKey=VOKGJWDSRLHHEA-UHFFFAOYSA-N

SMILES: S(NC1=NC=CS1)(=O)(=O)C2=CC=C(NN)C=C2.Cl

Synonyms:

• Benzenesulfonamide, 4-hydrazinyl-N-2-thiazolyl-, hydrochloride (1:2)

4-Hydrazinyl-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide dihydrochloride

CAS: 1375473-10-1

Versatile small molecule scaffold

Formula: C₉H₁₂Cl₂N₄O₂S₂

Purity: Min. 95%

Molecular weight: 343.3 g/mol

Ref: 3D-AFC47310