CymitQuimica logo

CAS 1375473-44-1

:

Methyl 3-(chlorosulfonyl)-5-(3-fluorophenyl)-2-thiophenecarboxylate

Description:
Methyl 3-(chlorosulfonyl)-5-(3-fluorophenyl)-2-thiophenecarboxylate is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring, a chlorosulfonyl group, and a fluorophenyl substituent. The presence of the chlorosulfonyl group indicates that this compound may exhibit strong electrophilic properties, making it potentially reactive in various chemical reactions. The fluorine atom in the 3-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. This compound may be of interest in medicinal chemistry and materials science due to its unique functional groups, which could facilitate interactions with biological targets or contribute to the development of novel materials. Additionally, the methyl ester functionality suggests that it may undergo hydrolysis or transesterification reactions, further expanding its potential applications. Overall, the compound's characteristics make it a subject of interest for further research in various chemical fields.
Formula:C12H8ClFO4S2
InChI:InChI=1S/C12H8ClFO4S2/c1-18-12(15)11-10(20(13,16)17)6-9(19-11)7-3-2-4-8(14)5-7/h2-6H,1H3
InChI key:InChIKey=BEQKPJRBPXVPRT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(S(Cl)(=O)=O)C=C(S1)C2=CC(F)=CC=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 3-(chlorosulfonyl)-5-(3-fluorophenyl)-, methyl ester
  • Methyl 3-(chlorosulfonyl)-5-(3-fluorophenyl)-2-thiophenecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.