CAS 1375474-14-8

2-Pyrrolidinone, 4-amino-1-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 4-amino-1-(1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. The presence of an amino group at the 4-position and a tert-butyl group (1,1-dimethylethyl) contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or in research contexts. Its molecular structure suggests it could participate in hydrogen bonding due to the amino and carbonyl functionalities, influencing its reactivity and interactions with other molecules. Additionally, the tert-butyl group may provide steric hindrance, affecting the compound's overall stability and reactivity. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-8(2,3)10-5-6(9)4-7(10)11;/h6H,4-5,9H2,1-3H3;1H

InChI key: InChIKey=XLLWYRWOANGKEM-UHFFFAOYSA-N

SMILES: C(C)(C)(C)N1C(=O)CC(N)C1.Cl

Synonyms:

• 2-Pyrrolidinone, 4-amino-1-(1,1-dimethylethyl)-, hydrochloride (1:1)

4-Amino-1-tert-butylpyrrolidin-2-one hydrochloride

CAS: 1375474-14-8

Versatile small molecule scaffold

Formula: C₈H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 192.68 g/mol

Ref: 3D-AFC47414