CAS 1375474-24-0

3-Pyrrolidinecarboxylic acid, 1-cyclohexyl-, hydrochloride (1:1)

Description:

3-Pyrrolidinecarboxylic acid, 1-cyclohexyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine and cyclohexyl functional groups, which contribute to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the pyrrolidine ring may influence its biological activity and interaction with biological systems. This compound may exhibit characteristics such as moderate to high melting points and specific solubility profiles, depending on the solvent used. Its structural features may also suggest potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its behavior and potential uses in various fields.

Formula: C₁₁H₁₉NO₂·ClH

InChI: InChI=1S/C11H19NO2.ClH/c13-11(14)9-6-7-12(8-9)10-4-2-1-3-5-10;/h9-10H,1-8H2,(H,13,14);1H

InChI key: InChIKey=HPBWVXIHYVXQMA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(CC1)C2CCCCC2.Cl

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-cyclohexyl-, hydrochloride (1:1)

1-Cyclohexylpyrrolidine-3-carboxylic acid hydrochloride

CAS: 1375474-24-0

Versatile small molecule scaffold

Formula: C₁₁H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 233.73 g/mol

Ref: 3D-AFC47424