CAS 1375474-28-4

Benzenamine, 3-(1-methylbutoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 3-(1-methylbutoxy)-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a substituted benzene ring. The presence of the 1-methylbutoxy group indicates that it has an alkoxy substituent, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit properties such as moderate to high polarity due to the amine and ether functionalities, which can affect its interaction with biological systems and other chemical species. Its structure suggests potential uses in pharmaceuticals or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as amines can be sensitive to air and moisture, and the hydrochloride form may have specific stability considerations. Overall, the compound's characteristics are defined by its functional groups, solubility, and potential applications in chemical synthesis or medicinal chemistry.

Formula: C₁₁H₁₇NO·ClH

InChI: InChI=1S/C11H17NO.ClH/c1-3-5-9(2)13-11-7-4-6-10(12)8-11;/h4,6-9H,3,5,12H2,1-2H3;1H

InChI key: InChIKey=CSVUQOGLJYEHLH-UHFFFAOYSA-N

SMILES: O(C(CCC)C)C1=CC(N)=CC=C1.Cl

Synonyms:

• Benzenamine, 3-(1-methylbutoxy)-, hydrochloride (1:1)

3-(Pentan-2-yloxy)aniline hydrochloride

CAS: 1375474-28-4

Versatile small molecule scaffold

Formula: C₁₁H₁₈ClNO

Purity: Min. 95%

Molecular weight: 215.72 g/mol

Ref: 3D-AFC47428