CAS 1375474-35-3

1H-Isoindole, 2-(2-bromoethyl)-2,3-dihydro-, hydrobromide (1:1)

Description:

1H-Isoindole, 2-(2-bromoethyl)-2,3-dihydro-, hydrobromide (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic aromatic system. The presence of a bromoethyl group indicates that it has a bromine atom attached to a two-carbon ethyl chain, contributing to its reactivity and potential applications in organic synthesis. The hydrobromide form suggests that the compound exists as a salt, which can enhance its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various interactions, including hydrogen bonding and electrophilic substitution, which can be exploited in chemical reactions. As with many brominated compounds, it may also possess unique properties related to its halogen content, such as increased lipophilicity or altered electronic characteristics. Safety and handling precautions are essential due to the potential toxicity associated with brominated organic compounds.

Formula: C₁₀H₁₂BrN.BrH

InChI: InChI=1S/C10H12BrN.BrH/c11-5-6-12-7-9-3-1-2-4-10(9)8-12;/h1-4H,5-8H2;1H

InChI key: InChIKey=TXTBRBZTEUQABO-UHFFFAOYSA-N

SMILES: C(CBr)N1CC=2C(C1)=CC=CC2.Br

2-(2-Bromoethyl)-2,3-dihydro-1H-isoindole hydrobromide

CAS: 1375474-35-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃Br₂N

Purity: Min. 95%

Molecular weight: 307.02 g/mol

Ref: 3D-AFC47435