
CAS 1375474-45-5
:Spiro[cyclopropane-1,1′(2′H)-naphthalen]-2-amine, 3′,4′-dihydro-, hydrochloride (1:1)
Description:
Spiro[cyclopropane-1,1′(2′H)-naphthalen]-2-amine, 3′,4′-dihydro-, hydrochloride (1:1), identified by CAS number 1375474-45-5, is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopropane ring with a naphthalene moiety. This compound features an amine functional group, contributing to its potential reactivity and interaction with biological systems. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water and stability. The presence of the dihydro configuration suggests partial saturation of the naphthalene ring, which may influence its electronic properties and reactivity. Such compounds are of interest in medicinal chemistry due to their potential pharmacological activities, including effects on neurotransmitter systems. The specific characteristics, such as melting point, solubility, and biological activity, would depend on the compound's detailed structural features and the conditions under which it is studied. Overall, this compound represents a fascinating area of research in organic and medicinal chemistry.
Formula:C12H15N·ClH
InChI:InChI=1S/C12H15N.ClH/c13-11-8-12(11)7-3-5-9-4-1-2-6-10(9)12;/h1-2,4,6,11H,3,5,7-8,13H2;1H
InChI key:InChIKey=RRZHJFNPPKWVOY-UHFFFAOYSA-N
SMILES:NC1C2(C=3C(CCC2)=CC=CC3)C1.Cl
Synonyms:- 3′,4′-Dihydro-2′H-spiro[cyclopropane-1,1′-naphthalene]-3-amine hydrochloride
- Spiro[cyclopropane-1,1′(2′H)-naphthalen]-2-amine, 3′,4′-dihydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3',4'-dihydro-2'H-spiro[cyclopropane-1,1'-naphthalene]-3-amine hydrochloride
CAS:Controlled ProductFormula:C12H15N·HClColor and Shape:NeatMolecular weight:209.715
