CAS 137553-48-1: 4-amino-5-fluoroquinazoline

Description:4-Amino-5-fluoroquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of an amino group at the 4-position and a fluorine atom at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The fluorine atom can enhance the lipophilicity and metabolic stability of the compound, which is advantageous in drug design. Additionally, 4-amino-5-fluoroquinazoline may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the reactivity of the amino group. Overall, its unique structural features and potential applications make it a compound of interest in both research and industrial contexts.

Formula:C₈H₆FN₃

InChI:InChI=1/C8H6FN3/c9-5-2-1-3-6-7(5)8(10)12-4-11-6/h1-4H,(H2,10,11,12)

Synonyms:
5-Fluoroquinazolin-4-Amine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Quinazolinamine, 5-fluoro- REF: IN-DA0013JNCAS: 137553-48-1	98%	57.00 €~169.00 €	Fri 21 Mar 25
4-Amino-5-fluoroquinazoline REF: 54-PC1076TCAS: 137553-48-1	95+%	152.00 €	Mon 24 Mar 25
4-Amino-5-fluoroquinazoline REF: 10-F003992CAS: 137553-48-1	98.0%	114.00 €~490.00 €	Mon 24 Mar 25
5-Fluoroquinazolin-4-amine REF: 3D-FF43610CAS: 137553-48-1	Min. 95%	- - -	Discontinued product