CAS 137571-73-4

5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one

Description:

5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one, with the CAS number 137571-73-4, is a chemical compound characterized by its unique structural features, including a benzodioxin core and multiple hydroxyl groups. This compound typically exhibits properties associated with phenolic compounds, such as antioxidant activity, due to the presence of hydroxyl groups that can donate hydrogen atoms. The dimethyl substitution at the 2,2-position contributes to its stability and may influence its solubility and reactivity. The compound's potential applications may span various fields, including pharmaceuticals and materials science, owing to its intriguing chemical properties. Additionally, the presence of the dioxin moiety suggests that it may participate in specific chemical reactions, such as electrophilic substitutions or complexation with metal ions. Overall, 5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one represents a compound of interest for further research, particularly in the context of its biological activities and potential therapeutic uses.

Formula: C₁₀H₁₀O₇

InChI: InChI=1S/C10H10O5/c1-10(2)14-7-4-5(11)3-6(12)8(7)9(13)15-10/h3-4,11-12H,1-2H3

SMILES: CC1(C)Oc2cc(cc(c2C(=O)O1)O)O

4H-1,3-Benzodioxin-4-one, 5,7-dihydroxy-2,2-dimethyl-

CAS: 137571-73-4

Formula: C₁₀H₁₀O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.1834

Ref: IN-DA0013KB

5 7-Dihydroxy-2 2-Dimethyl-4H-1 3-Benzo

CAS: 137571-73-4

5 7-Dihydroxy-2 2-Dimethyl-4H-1 3-Benzo

Purity: 97%

Molecular weight: 210.18g/mol

Ref: 54-OR1011690

5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one

Controlled Product

CAS: 137571-73-4

Applications 5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one is an intermediate for the synthesis of the precursor compound for Altenuene (A575740), a toxin isolated from the fungus Alternaria tenuis.
References Altemoeller, M., et al.: Europ. J. Org. Chem., 7, 1678 (2006); Ooguri, A., et al.: J. Am. Chem. Soc., 131, 13194 (2009);

Formula: C₁₀H₁₀O₅

Color and Shape: Neat

Molecular weight: 210.18

Ref: TR-D446710

5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one

CAS: 137571-73-4

Formula: C₁₀H₁₀O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.185

Ref: 10-F092086