CAS 137593-46-5
:toxic shock syndrome toxin-1 (58-78)
Description:
Toxic shock syndrome toxin-1 (TSST-1) is a potent exotoxin produced by certain strains of Staphylococcus aureus, particularly those associated with toxic shock syndrome. This superantigen is known for its ability to activate a large number of T-cells, leading to an overwhelming immune response that can result in severe systemic effects. TSST-1 is characterized by its heat stability and resistance to proteolytic enzymes, which allows it to persist in various environments. The toxin is composed of a single polypeptide chain and exhibits a molecular weight that classifies it as a small protein. Its mechanism of action involves binding to major histocompatibility complex (MHC) class II molecules and T-cell receptors, bypassing the normal antigen processing pathway. This results in the activation of a significant proportion of T-cells, leading to the release of cytokines and subsequent symptoms such as fever, rash, and multi-organ failure. Due to its potent effects, TSST-1 is a subject of interest in both clinical and research settings, particularly in understanding immune responses and developing therapeutic interventions.
Formula:C98H171N33O35
InChI:InChI=1/C98H171N33O35/c1-47(2)37-62(122-89(158)65(40-73(144)145)125-94(163)75(48(3)4)128-86(155)57(23-12-17-35-103)116-84(153)60(27-30-72(142)143)114-70(139)42-111-79(148)53(104)19-8-13-31-99)88(157)124-64(39-69(106)138)91(160)131-77(50(6)135)96(165)121-56(22-11-16-34-102)82(151)117-58(24-18-36-110-98(107)108)87(156)129-76(49(5)134)95(164)120-55(21-10-15-33-101)81(150)115-54(20-9-14-32-100)83(152)126-66(44-132)92(161)119-61(25-28-68(105)137)85(154)123-63(38-52-41-109-46-113-52)90(159)130-78(51(7)136)97(166)127-67(45-133)93(162)118-59(26-29-71(140)141)80(149)112-43-74(146)147/h41,46-51,53-67,75-78,132-136H,8-40,42-45,99-104H2,1-7H3,(H2,105,137)(H2,106,138)(H,109,113)(H,111,148)(H,112,149)(H,114,139)(H,115,150)(H,116,153)(H,117,151)(H,118,162)(H,119,161)(H,120,164)(H,121,165)(H,122,158)(H,123,154)(H,124,157)(H,125,163)(H,126,152)(H,127,166)(H,128,155)(H,129,156)(H,130,159)(H,131,160)(H,140,141)(H,142,143)(H,144,145)(H,146,147)(H4,107,108,110)/t49-,50-,51-,53+,54+,55+,56+,57+,58+,59+,60+,61+,62+,63+,64+,65+,66+,67+,75+,76+,77+,78+/m1/s1
Synonyms:- Tsst-1 (58-78)
- Glycine, L-lysylglycyl-L-alpha-glutamyl-L-lysyl-L-valyl-L-alpha-aspartyl-L-leucyl-L-asparaginyl-L-threonyl-L-lysyl-L-arginyl-L-threonyl-L-lysyl-L-lysyl-L-seryl-L-glutaminyl-L-histidyl-L-threonyl-L-seryl-L-alpha-glutamyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Toxic Shock Syndrome Toxin-1 (TSST-1) (58-78)
CAS:TSST-1 is a “superantigen” which binds to MHC class II molecules and induces stimulation of T cells. This TSST-1 fragment has an active site of the TSST-1 holotoxin which binds to MHC class II molecules and is able to xenostimulate T cells in an MHC unrestricted manner. Therefore this peptide could be of great value in studying the immunobiology of MHC class II molecules.Formula:C98H171N33O35Purity:97.8%Color and Shape:White LyophilisateMolecular weight:2371.64Toxic Shock Syndrome Toxin-1 (TSST-1) (58-78)
CAS:Please enquire for more information about Toxic Shock Syndrome Toxin-1 (TSST-1) (58-78) including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C98H171N33O35Purity:Min. 95%Molecular weight:2,371.61 g/mol


