CAS 1376380-75-4

3-Azetidinecarboxamide, N-ethyl-, hydrochloride (1:1)

Description:

3-Azetidinecarboxamide, N-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The N-ethyl substitution enhances its solubility and may influence its pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry and drug formulation. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which is often advantageous for enhancing bioavailability. Its unique structural features may allow for interactions with biological targets, making it of interest in the development of therapeutic agents. However, specific biological activity, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.

Formula: C₆H₁₂N₂O·ClH

InChI: InChI=1S/C6H12N2O.ClH/c1-2-8-6(9)5-3-7-4-5;/h5,7H,2-4H2,1H3,(H,8,9);1H

InChI key: InChIKey=CYVKAGSVDBSWOF-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C1CNC1.Cl

Synonyms:

• 3-Azetidinecarboxamide, N-ethyl-, hydrochloride (1:1)

N-Ethylazetidine-3-carboxamide hydrochloride

CAS: 1376380-75-4

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 164.63 g/mol

Ref: 3D-BFC38075