CAS 137654-20-7

2-FLUORO-3-METHOXYBENZOIC ACID

Description:

2-Fluoro-3-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methoxy group on a benzene ring. The fluorine atom is located at the second position, while the methoxy group is at the third position relative to the carboxylic acid functional group. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The methoxy group contributes to the compound's overall electron-donating character, influencing its reactivity and potential applications in organic synthesis. The fluorine substituent can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of both electron-withdrawing and electron-donating groups can lead to unique electronic properties, impacting its behavior in various chemical reactions. Overall, 2-fluoro-3-methoxybenzoic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₈H₇FO₃

InChI: InChI=1/C8H7FO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11)

SMILES: COc1cccc(c1F)C(=O)O

Synonyms:

• 2-Fluoro-3-methoxybenzoic acid 98%
• 2-Fluoro-3-methoxybenzoicacid98%
• 2-Fluoro-3-Methoxybenzoate

Benzoic acid, 2-fluoro-3-methoxy-

CAS: 137654-20-7

Formula: C₈H₇FO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 170.1378

Ref: IN-DA0013OH

2-Fluoro-3-methoxybenzoic acid

CAS: 137654-20-7

2-Fluoro-3-methoxybenzoic acid

Formula: C₈H₇FO₃

Purity: 99%

Color and Shape: faint yellow crystalline needles

Molecular weight: 170.14g/mol

Ref: 54-PC9295

2-Fluoro-3-methoxybenzoic Acid

CAS: 137654-20-7

Formula: C₈H₇FO₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 170.14

Ref: 3B-F1218

2-Fluoro-3-methoxybenzoic acid

CAS: 137654-20-7

Formula: C₈H₇FO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 170.139

Ref: 10-F035004