CAS 137654-21-8
:2-Fluoro-6-methoxybenzoic acid
Description:
2-Fluoro-6-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methoxy group on a benzoic acid framework. The fluorine substituent is located at the second position, while the methoxy group is at the sixth position of the benzene ring, influencing the compound's reactivity and solubility. This compound typically exhibits moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group can also contribute to the compound's electron-donating properties, affecting its acidity and reactivity in various chemical reactions. 2-Fluoro-6-methoxybenzoic acid may be utilized in organic synthesis and pharmaceutical applications, particularly in the development of biologically active compounds. Its unique structural features make it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7FO3
InChI:InChI=1S/C8H7FO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=XLNQGZLCGVLNMF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC=C1F
Synonyms:- 2-Chloro-1-Fluoro-4-Isothiocyanatobenzene
- 6-Fluoro-2-methoxybenzoic acid
- 6-Fluoro-o-anisic acid
- Benzoic acid,2-fluoro-6-methoxy-
- 2-Fluoro-6-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 2-fluoro-6-methoxy-
CAS:Formula:C8H7FO3Purity:97%Color and Shape:SolidMolecular weight:170.13782-Fluoro-6-methoxybenzoic acid
CAS:2-Fluoro-6-methoxybenzoic acidFormula:C8H7FO3Purity:98%Color and Shape: off-white/pale lemon solidMolecular weight:170.14g/mol2-Fluoro-6-methoxybenzoic Acid
CAS:Formula:C8H7FO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:170.142-Fluoro-6-methoxybenzoic acid
CAS:<p>2-Fluoro-6-methoxybenzoic acid is a monocarboxylic acid that is synthesized from 2,6-dichlorobenzoic acid by a mediated, synthetic sequence. This compound can be used as a substrate for kinetic analyses of the transport of carboxylic acids across cellular membranes. The uptake of 2-fluoro-6-methoxybenzoic acid is expressed in the apical surface membrane of Caco2 cells. Kinetic studies indicate that this compound reacts rapidly with butyllithium to form an enamine intermediate. The enamine intermediate then reacts with either water or methanol to produce a final product, depending on the reaction time.</p>Formula:C8H7FO3Purity:Min. 95%Color and Shape:PowderMolecular weight:170.14 g/mol2-Fluoro-6-methoxybenzoic acid
CAS:Formula:C8H7FO3Purity:95%Color and Shape:SolidMolecular weight:170.139




