CymitQuimica logo

CAS 137654-50-3

:

Acetamide, N-1H-benzimidazol-4-yl- (9CI)

Description:
Acetamide, N-1H-benzimidazol-4-yl- (9CI), with the CAS number 137654-50-3, is an organic compound characterized by the presence of a benzimidazole moiety attached to an acetamide functional group. This compound typically exhibits properties associated with both amides and heterocyclic compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and alcohols, due to the presence of the amide group which can engage in hydrogen bonding. The benzimidazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit moderate stability under standard conditions but could be sensitive to extreme pH or temperature changes. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-6(13)12-8-4-2-3-7-9(8)11-5-10-7/h2-5H,1H3,(H,10,11)(H,12,13)
InChI key:OWMVAMRYJFFXML-UHFFFAOYSA-N
SMILES:CC(=O)NC1=CC=CC2=C1N=CN2
Found 0 products.