CAS 137686-91-0
:3,4,6-TRI-O-ACETYL-2-DEOXY-2-PHTHALIMIDO-D-GLUCOPYRANOSYL BROMIDE
Description:
3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranosyl bromide is a chemical compound that belongs to the class of glycosyl bromides, which are often used in glycosylation reactions in organic synthesis. This compound features a glucopyranosyl moiety, which is a six-membered cyclic form of glucose, modified with three acetyl groups at the 3, 4, and 6 positions, enhancing its lipophilicity and stability. The presence of a phthalimido group at the 2-position provides additional functionalization, making it useful in various synthetic applications. The bromide substituent is a good leaving group, facilitating nucleophilic substitution reactions. This compound is typically utilized in the synthesis of glycosides and other carbohydrate derivatives, playing a significant role in carbohydrate chemistry and medicinal chemistry. Its structural characteristics contribute to its reactivity and potential applications in the development of pharmaceuticals and biologically active compounds. As with many chemical substances, proper handling and safety precautions are essential due to its reactivity and potential hazards.
Formula:C14H17F4NO8
InChI:InChI=1/C14H17F4NO8/c1-5(20)24-4-8-10(25-6(2)21)11(26-7(3)22)9(12(15)27-8)19-13(23)14(16,17)18/h8-12H,4H2,1-3H3,(H,19,23)
SMILES:CC(=O)OCC1C(C(C(C(F)O1)N=C(C(F)(F)F)O)OC(=O)C)OC(=O)C
Synonyms:- 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranosyl Fluoride
- 3,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosylfluoride
- 2-Trifluroacetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Ss-D-Glucopyranosyl Fluoride
- 3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]hexopyranosyl fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Trifluoroacetamido-3,4,6-tri-o-acetyl-2-deoxy-β-d-glucopyranosyl fluoride
CAS:Formula:C14H17F4NO8Color and Shape:SolidMolecular weight:403.28032-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl Fluoride
CAS:Molecular weight:403.283,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosyl fluoride
CAS:3,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosyl fluoride is a synthetic sugar that can be used to modify glycosylations. This product is offered in high purity and has been modified with click chemistry. Click chemistry is a chemical reaction that creates stable carbon–carbon bonds. This modification allows for the attachment of small molecules to the sugar without affecting its structure.Formula:C14H17F4NO8Purity:Min. 95%Color and Shape:White PowderMolecular weight:403.28 g/mol2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl Fluoride
CAS:Controlled ProductFormula:C14H17F4NO8Color and Shape:NeatMolecular weight:403.28



