CAS 137686-92-1: 4-Methylumbelliferyl3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-a-D-glucopyranoside
Description:4-Methylumbelliferyl 3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-α-D-glucopyranoside is a synthetic compound primarily used as a substrate in biochemical assays, particularly for the detection of glycosidase enzymes. This compound features a 4-methylumbelliferone moiety, which is a fluorescent marker, allowing for sensitive detection when the glycosidase cleaves the glycosidic bond. The presence of multiple acetyl groups enhances the compound's stability and solubility in organic solvents, while the trifluoroacetamido group contributes to its chemical reactivity and specificity in enzymatic reactions. The compound is typically characterized by its fluorescence properties, which can be measured using spectrophotometry, and its structure can be confirmed through techniques such as NMR and mass spectrometry. Due to its specific reactivity, it is valuable in research and diagnostic applications, particularly in studying carbohydrate-active enzymes. Safety data should be consulted, as the trifluoroacetamido group may pose certain hazards.
Formula:C24H24F3NO11
InChI:InChI=1S/C24H24F3NO11/c1-10-7-18(32)38-16-8-14(5-6-15(10)16)37-22-19(28-23(33)24(25,26)27)21(36-13(4)31)20(35-12(3)30)17(39-22)9-34-11(2)29/h5-8,17,19-22H,9H2,1-4H3,(H,28,33)/t17-,19-,20-,21-,22+/m1/s1
InChI key:InChIKey=MGLRSUPYLXVODY-FYKMYLNBSA-N
SMILES:O=C1OC=2C=C(OC3OC(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C3NC(=O)C(F)(F)F)C=CC2C(=C1)C
- Synonyms:
- 2H-1-Benzopyran-2-one, 4-methyl-7-[[3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]-α-D-glucopyranosyl]oxy]-

4-Methylumbelliferyl 3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-a-D-glucopyranoside
Ref: 7W-GC6176
Undefined size | To inquire |

4-Methylumbelliferyl 2-Trifluoroacetyl-3,4,6-O-triacetyl-2-deoxy-Alpha-D-glucopyranoside
Controlled ProductRef: TR-M337625
5mg | 102.00 € | ||
10mg | 111.00 € | ||
25mg | 174.00 € |

4-Methylumbelliferyl 3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-a-D-glucopyranoside
Ref: 3D-EM05984
10mg | 344.00 € | ||
25mg | 562.00 € |