CAS 137718-84-4
:3,4-DIBROMO-2-FLUOROPYRIDINE
Description:
3,4-Dibromo-2-fluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and one fluorine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. The bromine atoms, being larger and more electronegative than hydrogen, enhance the compound's electrophilic character, making it useful in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. The fluorine atom contributes to the compound's overall electronegativity and can affect its solubility and interaction with biological systems. 3,4-Dibromo-2-fluoropyridine is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the synthesis of biologically active compounds. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C5H2Br2FN
InChI:InChI=1/C5H2Br2FN/c6-3-1-2-9-5(8)4(3)7/h1-2H
SMILES:c1cnc(c(c1Br)Br)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-Dibromo-2-fluoropyridine
CAS:3,4-Dibromo-2-fluoropyridine
Color and Shape:SolidMolecular weight:254.88g/mol

