CAS 13772-61-7
:2-Naphthalenecarboxylic acid, 4-fluoro-
Description:
2-Naphthalenecarboxylic acid, 4-fluoro- is an aromatic carboxylic acid characterized by the presence of a naphthalene ring system substituted with a carboxylic acid group and a fluorine atom at the 4-position. This compound typically exhibits a solid state at room temperature and is known for its relatively high melting point compared to many other organic compounds. The presence of the fluorine atom can influence its reactivity and solubility, often enhancing its lipophilicity and potentially affecting its biological activity. As a carboxylic acid, it can participate in typical acid-base reactions and may form esters or amides under appropriate conditions. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Additionally, the compound's properties, such as solubility in organic solvents and stability under various conditions, make it of interest in both industrial and research settings. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H7FO2
InChI:InChI=1S/C11H7FO2/c12-10-6-8(11(13)14)5-7-3-1-2-4-9(7)10/h1-6H,(H,13,14)
InChI key:InChIKey=OHUWXPXKWRJJFR-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=C(C(O)=O)C1)C=CC=C2
Synonyms:- 4-Fluoro-2-naphthalenecarboxylic acid
- 2-Naphthalenecarboxylic acid, 4-fluoro-
- 1-Fluoro-3-naphthalenecarboxylic acid
- 1-Fluoro-3-naphthoic acid
- 2-Naphthoic acid, 4-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Fluoronaphthalene-2-carboxylic acid
CAS:<p>4-Fluoronaphthalene-2-carboxylic acid is a synthetic compound that belongs to the class of nitro compounds. This compound has been shown to have constant connectivity with quinoline and naphthoic acid. 4-Fluoronaphthalene-2-carboxylic acid has also been found to be ionizable and ionic, showing correlations with water solubility. It is an organic carboxylic acid that can be used in the synthesis of other chemicals, such as quinoline derivatives or naphthoic acids.</p>Formula:C11H7FO2Purity:Min. 95%Molecular weight:190.17 g/mol
