CAS 137740-37-5

1-[2-[2-(tert-butylamino)-1-hydroxy-ethyl]benzofuran-7-yl]ethanone hydrochloride

Description:

1-[2-[2-(tert-butylamino)-1-hydroxy-ethyl]benzofuran-7-yl]ethanone hydrochloride, with the CAS number 137740-37-5, is a chemical compound characterized by its complex structure that includes a benzofuran moiety, a tert-butylamino group, and a hydroxyethyl substituent. This compound typically exhibits properties associated with both amines and ketones, which may influence its solubility, reactivity, and biological activity. The presence of the hydrochloride salt form suggests enhanced stability and solubility in aqueous environments, making it suitable for various applications, including potential pharmaceutical uses. Its structural features may impart specific pharmacological properties, potentially affecting neurotransmitter systems or other biological pathways. As with many organic compounds, the characteristics such as melting point, boiling point, and spectral properties (NMR, IR, etc.) would be essential for identification and characterization but are not specified here. Overall, this compound represents a unique blend of functional groups that may contribute to its utility in medicinal chemistry or related fields.

Formula: C₁₆H₂₂ClNO₃

InChI: InChI=1/C16H21NO3.ClH/c1-10(18)12-7-5-6-11-8-14(20-15(11)12)13(19)9-17-16(2,3)4;/h5-8,13,17,19H,9H2,1-4H3;1H

SMILES: CC(=O)c1cccc2cc(C(CNC(C)(C)C)O)oc12.Cl

1'-Oxpbufuralol HCl

CAS: 137740-37-5

Formula: C₁₆H₂₁NO₃·HCl

Molecular weight: 275.35 36.46

Ref: 4Z-B-257

1’-Oxobufuralol Hydrochloride

Controlled Product

CAS: 137740-37-5

Applications A metabolite of Bufuralol, a β-Adrenergic blocker with peripheral vasodilating activity.
References Francis, R.J., et al.: Eur. J. Clin. Pharmacol., 23, 529 (1982), Pringle, T.H., et al.: Br. J. Clin. Pharmacol., 22, 527 (1986),

Formula: C₁₆H₂₂ClNO₃

Color and Shape: Neat

Molecular weight: 311.8

Ref: TR-O847500

1’-Oxobufuralol Hydrochloride

CAS: 137740-37-5

Formula: C₁₆H₂₁NO₃HCl

Molecular weight: 275.35 : 36.46

Ref: ST-EA-CP-B139007