CAS 137756-90-2

B-[4-(2-Bromoethyl)phenyl]boronic acid

Description:

B-[4-(2-Bromoethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a bromoethyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the bromoethyl group enhances its reactivity, allowing for potential coupling reactions in the formation of carbon-carbon bonds. Additionally, boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the synthesis of complex organic molecules. The compound is likely to be a solid at room temperature, with solubility in polar organic solvents. Its reactivity and functionalization potential make it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound due to the presence of bromine, which can be hazardous.

Formula: C₈H₁₀BBrO₂

InChI: InChI=1S/C8H10BBrO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,11-12H,5-6H2

InChI key: InChIKey=FFNGHXMQOMKXOW-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC=C(CCBr)C=C1

Synonyms:

• [4-(2-Bromoethyl)phenyl]boronic acid
• B-[4-(2-Bromoethyl)phenyl]boronic acid
• (4-(2-Bromoethyl)phenyl)boronicacid
• Boronic acid, B-[4-(2-bromoethyl)phenyl]-
• Boronic acid, [4-(2-bromoethyl)phenyl]-

Boronic acid, [4-(2-bromoethyl)phenyl]- (9CI)

CAS: 137756-90-2

Formula: C₈H₁₀BBrO₂

Purity: 97%

Molecular weight: 228.8788

Ref: IN-DA0013SQ

4-(2-Bromoethyl)phenylboronic acid

CAS: 137756-90-2

4-(2-Bromoethyl)phenylboronic acid

Purity: ≥95%

Molecular weight: 228.88g/mol

Ref: 54-OR360782

(4-(2-Bromoethyl)phenyl)boronic acid

CAS: 137756-90-2

Formula: C₈H₁₀BBrO₂

Purity: 95.0%

Molecular weight: 228.88

Ref: 10-F211358