CAS 137801-55-9
:galacardin A
Description:
Galacardin A, with the CAS number 137801-55-9, is a natural product that belongs to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus Penicillium. This compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Galacardin A has garnered interest in the field of medicinal chemistry due to its potential antimicrobial and anticancer properties. Its mechanism of action often involves the inhibition of specific enzymes or pathways within target cells, making it a subject of research for therapeutic applications. Additionally, like many natural products, galacardin A may exhibit a range of biological activities, including cytotoxicity against various cancer cell lines. The study of galacardin A and similar compounds continues to be significant in the search for new pharmaceuticals derived from natural sources.
Formula:C101H121Cl2N9O46
InChI:InChI=1/C101H121Cl2N9O46/c1-32-70(120)48(104)26-60(143-32)154-87-39-11-18-52(47(103)21-39)148-55-23-40-22-54(88(55)158-101-89(79(129)75(125)59(31-116)153-101)155-61-27-49(105)71(121)33(2)144-61)146-42-14-7-36(8-15-42)86(157-100-83(133)78(128)74(124)58(30-115)152-100)68(111-90(135)63(106-4)35-5-12-43(13-6-35)147-97-84(134)80(130)85(34(3)145-97)156-99-82(132)77(127)73(123)57(29-114)151-99)94(139)108-65(38-10-17-53(46(102)20-38)149-98-81(131)76(126)72(122)56(28-113)150-98)91(136)109-66(40)93(138)107-64-37-9-16-50(118)44(19-37)62-45(24-41(117)25-51(62)119)67(96(141)142)110-95(140)69(87)112-92(64)137/h5-25,32-34,48-49,56-61,63-87,89,97-101,106,113-134H,26-31,104-105H2,1-4H3,(H,107,138)(H,108,139)(H,109,136)(H,110,140)(H,111,135)(H,112,137)(H,141,142)
Synonyms:- Galacardin A
- Avoparcin alpha, 49-chloro-4B,50-di-O-alpha-D-mannopyranosyl-
- galacardin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Galacardin A
CAS:Galacardin A exhibits activity against Gram-positive bacteria.Formula:C101H121Cl2N9O46Color and Shape:SolidMolecular weight:2267.98
