CAS 13782-02-0
:Cobalt(2+), pentaammine(nitrito-κN)-, chloride (1:2), (OC-6-22)-
Description:
Cobalt(2+), pentaammine(nitrito-κN)-, chloride (1:2), also known by its CAS number 13782-02-0, is a coordination compound featuring cobalt in a +2 oxidation state. This complex consists of a cobalt ion coordinated to five ammonia (NH3) ligands and one nitrito ligand, which is bound through the nitrogen atom (κN). The chloride ions serve as counterions, balancing the overall charge of the complex. The structure typically exhibits octahedral geometry due to the coordination of six donor atoms around the cobalt center. The presence of the nitrito ligand introduces interesting reactivity and potential applications in fields such as catalysis and materials science. The compound is characterized by its distinct color, which can vary depending on the ligands and their arrangement. Additionally, it may exhibit specific solubility properties in various solvents, influencing its behavior in chemical reactions. Overall, this compound exemplifies the rich chemistry of transition metal complexes and their diverse applications.
Formula:ClCoH15N6O2
InChI:InChI=1S/2ClH.Co.NO2.5H3N/c;;;2-1-3;;;;;/h2*1H;;;5*1H3/q;;+3;-1;;;;;/p-2
InChI key:InChIKey=RIGHXKINSGXWBS-UHFFFAOYSA-L
SMILES:[Co+3]([N-](=O)=O)([NH3])([NH3])([NH3])([NH3])[NH3].[Cl-]
Synonyms:- Cobalt(2+), pentaammine(nitrito-κN)-, chloride (1:2), (OC-6-22)-
- Cobalt(2+), pentaamminenitro-, dichloride
- Cobalt(2+), pentaammine(nitrito-κN)-, dichloride, (OC-6-22)-
- Nitropentaamminecobalt dichloride
- Cobalt(2+), pentaammine(nitrito-N)-, dichloride, (OC-6-22)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cobalt(2+), pentaammine(nitrito-κN)-, chloride (1:2), (OC-6-22)-
CAS:Formula:CoH2N2O2Molecular weight:120.9613
