CAS 1378260-25-3

Methyl 8-bromo-6-quinoxalinecarboxylate

Description:

Methyl 8-bromo-6-quinoxalinecarboxylate is a chemical compound characterized by its quinoxaline core, which is a bicyclic structure containing two nitrogen atoms. This compound features a bromine atom at the 8-position and a carboxylate ester functional group at the 6-position, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The bromine substituent can serve as a site for further functionalization, allowing for the introduction of diverse chemical groups. Quinoxaline derivatives are known for their biological activity, including antimicrobial and anticancer properties, making this compound of interest in pharmaceutical research. Additionally, its unique structure may facilitate interactions with biological targets, potentially leading to the development of new therapeutic agents. Overall, Methyl 8-bromo-6-quinoxalinecarboxylate is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₇BrN₂O₂

InChI: InChI=1S/C10H7BrN2O2/c1-15-10(14)6-4-7(11)9-8(5-6)12-2-3-13-9/h2-5H,1H3

InChI key: InChIKey=FPHVJQGDEZIMJR-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=C(C(OC)=O)C1)N=CC=N2

Synonyms:

• 6-Quinoxalinecarboxylic acid, 8-bromo-, methyl ester
• Methyl 8-bromo-6-quinoxalinecarboxylate

Methyl 8-bromoquinoxaline-6-carboxylate

CAS: 1378260-25-3

Versatile small molecule scaffold

Formula: C₁₀H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 267.08 g/mol

Ref: 3D-DFC26025