CAS 137832-56-5

methyl 4-amino-5-iodo-2-methoxy-benzoate

Description:

Methyl 4-amino-5-iodo-2-methoxy-benzoate, with the CAS number 137832-56-5, is an organic compound characterized by its aromatic structure, which includes a methoxy group and an amino group attached to a benzoate moiety. This compound features an iodine atom, which contributes to its unique reactivity and potential applications in medicinal chemistry. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. Methyl 4-amino-5-iodo-2-methoxy-benzoate is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups suggest potential for hydrogen bonding and interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the iodine substituent may facilitate further chemical modifications or serve as a labeling agent in imaging studies. Overall, this compound's structural features position it as a valuable candidate for further investigation in various chemical and biological applications.

Formula: C₉H₁₀INO₃

InChI: InChI=1/C9H10INO3/c1-13-8-4-7(11)6(10)3-5(8)9(12)14-2/h3-4H,11H2,1-2H3

SMILES: COc1cc(c(cc1C(=O)OC)I)N

Methyl 4-amino-5-iodo-2-methoxybenzoate

CAS: 137832-56-5

Formula: C₉H₁₀INO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 307.087

Ref: 10-F217803

Benzoic acid, 4-amino-5-iodo-2-methoxy-, methyl ester

CAS: 137832-56-5

Formula: C₉H₁₀INO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 307.0851

Ref: IN-DA0013X2

Methyl 4-amino-5-iodo-2-methoxybenzoate

CAS: 137832-56-5

Methyl 4-amino-5-iodo-2-methoxybenzoate

Purity: 95%

Molecular weight: 307.087g/mol

Ref: 54-OR74316

Methyl 4-amino-5-iodo-2-methoxybenzoate

CAS: 137832-56-5

Methyl 4-amino-5-iodo-2-methoxybenzoate is a chemical compound that is used to synthesize other compounds. It is used in the synthesis of alkaloids, such as clausine and glycozoline. The intramolecular arylation of boronic acids with methyl 4-amino-5-iodo-2-methoxybenzoate provides an efficient methodology for the synthesis of cross-coupled products. This reaction can be carried out using copper as a catalyst, which has been shown to reduce the need for expensive reagents.

Formula: C₉H₁₀INO₃

Purity: Min. 95%

Molecular weight: 307.09 g/mol

Ref: 3D-MFA83256

Methyl 4-amino-5-iodo-2-methoxybenzoate

CAS: 137832-56-5

Formula: C₉H₁₀INO₃

Molecular weight: 307.09

Ref: ST-EA-CP-A30052