
CAS 137836-88-5
:1H-Imidazolium, 1,3-bis(1-methylethyl)-, hydroxide (1:1)
Description:
1H-Imidazolium, 1,3-bis(1-methylethyl)-, hydroxide (1:1), commonly referred to as a type of ionic liquid, is characterized by its imidazolium cation structure, which features a five-membered aromatic ring containing two nitrogen atoms. This compound typically exhibits a high degree of thermal stability and low volatility, making it suitable for various applications in organic synthesis and catalysis. The presence of the hydroxide anion contributes to its basicity and potential as a solvent for polar and ionic compounds. Additionally, the bulky isopropyl groups attached to the imidazolium ring enhance its solubility in organic solvents while reducing crystallinity, which is a common trait of ionic liquids. This substance is often explored for its role in green chemistry due to its ability to facilitate reactions with reduced environmental impact. Its unique properties, such as ionic conductivity and tunable viscosity, make it a subject of interest in fields ranging from electrochemistry to materials science.
Formula:C9H17N2·HO
InChI:InChI=1S/C9H17N2.H2O/c1-8(2)10-5-6-11(7-10)9(3)4;/h5-9H,1-4H3;1H2/q+1;/p-1
InChI key:InChIKey=HXGZXUVDQQOSAR-UHFFFAOYSA-M
SMILES:C(C)(C)[N+]1=CN(C(C)C)C=C1.[OH-]
Synonyms:- 1,3-Diisopropyl-1H-imidazolium hydroxide
- 1H-Imidazolium, 1,3-bis(1-methylethyl)-, hydroxide
- 1H-Imidazolium, 1,3-bis(1-methylethyl)-, hydroxide (1:1)
- 1,3-Bis(propan-2-yl)-1H-imidazol-3-ium hydroxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Diisopropyl-1H-imidazolium Hydroxide
CAS:Controlled ProductFormula:C9H17N2•OHColor and Shape:NeatMolecular weight:153.24 + (17.01)
