CAS 137862-87-4: Valsartan
Description:Valsartan is an angiotensin II receptor blocker (ARB) primarily used in the treatment of hypertension and heart failure. Its chemical formula is C24H29N5O3, and it features a biphenyl structure with a tetrazole ring, which contributes to its pharmacological activity. Valsartan works by inhibiting the action of angiotensin II, a hormone that causes blood vessels to constrict, thereby promoting vasodilation and reducing blood pressure. The substance is typically administered orally and is known for its relatively long half-life, allowing for once-daily dosing. Valsartan is generally well-tolerated, but like all medications, it may have side effects, including dizziness, fatigue, and potential renal impairment. It is contraindicated in certain populations, such as pregnant women, due to the risk of fetal harm. The compound is also subject to various regulatory standards to ensure its safety and efficacy in clinical use.
Formula:C24H29N5O3
InChI:InChI=1/C24H29N5O3/c1-4-5-10-21(30)29(22(16(2)3)24(31)32)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)23-25-27-28-26-23/h6-9,11-14,16,22H,4-5,10,15H2,1-3H3,(H,31,32)(H,25,26,27,28)/t22-/m1/s1
- Synonyms:
- 3-Methyl-2-[Pentanoyl-[[4-[2-(2H-Tetrazol-5-Yl)Phenyl]Phenyl]Methyl]Amino]-Butanoic Acid
- N-pentanoyl-N-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}valine
- N-pentanoyl-N-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}-L-valine
- N-pentanoyl-N-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}-D-valine
- D-Valine, N-(1-oxopentyl)-N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-
- Valsartan(Diovan)
- N-(1-Oxopentyl)-N-((2'-(1H-Tetrazol-5-Yl)(1,1'-Biphenyl)-3-Yl)Methyl)-L-Valine