CAS 13788-59-5
:N-(2-benzoyl-4-chloro-phenyl)acetamide
Description:
N-(2-benzoyl-4-chloro-phenyl)acetamide, with the CAS number 13788-59-5, is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic system. This compound features a benzoyl group and a 4-chloro-substituted phenyl moiety, contributing to its unique chemical properties. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro substituent can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. This compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C15H12ClNO2
InChI:InChI=1/C15H12ClNO2/c1-10(18)17-14-8-7-12(16)9-13(14)15(19)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18)
SMILES:CC(=Nc1ccc(cc1C(=O)c1ccccc1)Cl)O
Synonyms:- acetamide, N-(2-benzoyl-4-chlorophenyl)-
- N-(2-Benzoyl-4-chlorophenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
