CymitQuimica logo

CAS 1378867-74-3

:

5-Bromo-3-methyl-1H-thieno[3,2-c]pyrazole

Description:
5-Bromo-3-methyl-1H-thieno[3,2-c]pyrazole is a heterocyclic compound characterized by its unique structural features, which include a thieno ring fused to a pyrazole moiety. The presence of a bromine atom at the 5-position and a methyl group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the thieno and pyrazole rings, which are known for their diverse biological activities. Additionally, the bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. As with many heterocycles, the compound may also display interesting electronic properties, making it a subject of interest in materials science and organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C6H5BrN2S
InChI:InChI=1S/C6H5BrN2S/c1-3-6-4(9-8-3)2-5(7)10-6/h2H,1H3,(H,8,9)
InChI key:InChIKey=FFCNXQIZVXXNGO-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(Br)S2)NN1
Synonyms:
  • 5-Bromo-3-methyl-1H-thieno[3,2-c]pyrazole
  • 1H-Thieno[3,2-c]pyrazole, 5-bromo-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.